C28H18N2O5 — CID 58721409
6-methyl-13-[4-(4-methylphenoxy)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 58721409) has the molecular formula C28H18N2O5 and a molecular weight of 462.46 g/mol. Its IUPAC name is 6-methyl-13-[4-(4-methylphenoxy)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-methyl-13-[4-(4-methylphenoxy)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 58721409 |
| Molecular Formula | C28H18N2O5 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 6-methyl-13-[4-(4-methylphenoxy)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)c4ccc5c6c(ccc(c46)C3=O)C(=O)N(C)C5=O)cc2)cc1 |
| InChI | InChI=1S/C28H18N2O5/c1-15-3-7-17(8-4-15)35-18-9-5-16(6-10-18)30-27(33)21-13-11-19-23-20(26(32)29(2)25(19)31)12-14-22(24(21)23)28(30)34/h3-14H,1-2H3 |
| InChIKey | FSEWAPGFGLPEOK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|