C23H33N — CID 58722053
N,2,3,4,5,6-hexamethyl-N-(2,3,4,5,6-pentamethylphenyl)aniline (PubChem CID 58722053) has the molecular formula C23H33N and a molecular weight of 323.52 g/mol. Its IUPAC name is N,2,3,4,5,6-hexamethyl-N-(2,3,4,5,6-pentamethylphenyl)aniline.
| Compound Name | N,2,3,4,5,6-hexamethyl-N-(2,3,4,5,6-pentamethylphenyl)aniline |
|---|---|
| PubChem CID | 58722053 |
| Molecular Formula | C23H33N |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | N,2,3,4,5,6-hexamethyl-N-(2,3,4,5,6-pentamethylphenyl)aniline |
| SMILES | Cc1c(C)c(C)c(N(C)c2c(C)c(C)c(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C23H33N/c1-12-14(3)18(7)22(19(8)15(12)4)24(11)23-20(9)16(5)13(2)17(6)21(23)10/h1-11H3 |
| InChIKey | FHUIIGLYETUCCM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |