C33H30F2N2O11 — CID 58722190
(2,5-dioxopyrrolidin-1-yl) 2-[18-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-2,5,8,11-tetraoxa-14-azabicyclo[13.4.0]nonadeca-1(15),16,18-trien-14-yl]acetate (PubChem CID 58722190) has the molecular formula C33H30F2N2O11 and a molecular weight of 668.60 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[18-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-2,5,8,11-tetraoxa-14-azabicyclo[13.4.0]nonadeca-1(15),16,18-trien-14-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[18-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-2,5,8,11-tetraoxa-14-azabicyclo[13.4.0]nonadeca-1(15),16,18-trien-14-yl]acetate |
|---|---|
| PubChem CID | 58722190 |
| Molecular Formula | C33H30F2N2O11 |
| Molecular Weight | 668.60 g/mol |
| Exact Mass | 668.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[18-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-2,5,8,11-tetraoxa-14-azabicyclo[13.4.0]nonadeca-1(15),16,18-trien-14-yl]acetate |
| SMILES | O=C(CN1CCOCCOCCOCCOc2cc(-c3c4cc(F)c(=O)cc-4oc4cc(O)c(F)cc34)ccc21)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C33H30F2N2O11/c34-22-14-20-27(16-25(22)38)47-28-17-26(39)23(35)15-21(28)33(20)19-1-2-24-29(13-19)46-12-11-45-10-9-44-8-7-43-6-5-36(24)18-32(42)48-37-30(40)3-4-31(37)41/h1-2,13-17,38H,3-12,18H2 |
| InChIKey | IWZRDLSPVBGLEY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 154.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|