C14H11N2+ — CID 58722713
1-aza-7-azoniatetracyclo[7.7.0.02,7.010,15]hexadeca-2,4,6,9,11,13,15-heptaene (PubChem CID 58722713) has the molecular formula C14H11N2+ and a molecular weight of 207.26 g/mol. Its IUPAC name is 1-aza-7-azoniatetracyclo[7.7.0.02,7.010,15]hexadeca-2,4,6,9,11,13,15-heptaene.
| Compound Name | 1-aza-7-azoniatetracyclo[7.7.0.02,7.010,15]hexadeca-2,4,6,9,11,13,15-heptaene |
|---|---|
| PubChem CID | 58722713 |
| Molecular Formula | C14H11N2+ |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1-aza-7-azoniatetracyclo[7.7.0.02,7.010,15]hexadeca-2,4,6,9,11,13,15-heptaene |
| SMILES | c1cc[n+]2c(c1)-n1cc3ccccc3c1C2 |
| InChI | InChI=1S/C14H11N2/c1-2-6-12-11(5-1)9-16-13(12)10-15-8-4-3-7-14(15)16/h1-9H,10H2/q+1 |
| InChIKey | YFYPHIDEZKBKDP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|