About 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane
4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane (PubChem CID 58722769) has the molecular formula C19H33NO10Si
and a molecular weight of 463.56 g/mol. Its IUPAC name is 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane.
Molecular Properties
| Compound Name | 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane |
| PubChem CID | 58722769 |
| Molecular Formula | C19H33NO10Si |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane |
| SMILES | CCOc1c(OC)c(OC)c(COCCCC[Si](OC)(OC)OC)c([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C19H33NO10Si/c1-8-30-19-17(24-3)15(20(21)22)14(16(23-2)18(19)25-4)13-29-11-9-10-12-31(26-5,27-6)28-7/h8-13H2,1-7H3 |
| InChIKey | GTVPGRQTJIBTLY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 116.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane?
The IUPAC name of 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane (CID 58722769) is 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane.
What is the SMILES notation for 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane?
The canonical SMILES for 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane is CCOc1c(OC)c(OC)c(COCCCC[Si](OC)(OC)OC)c([N+](=O)[O-])c1OC.
What is the InChIKey of 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane?
The InChIKey is GTVPGRQTJIBTLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO10Si/c1-8-30-19-17(24-3)15(20(21)22)14(16(23-2)18(19)25-4)13-29-11-9-10-12-31(26-5,27-6)28-7/h8-13H2,1-7H3.
What are the key properties of 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane?
4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane has a molecular weight of 463.56 g/mol, XLogP of 3.19, 16 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-ethoxy-2,3,5-trimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane is sourced from PubChem (CID 58722769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).