C16H18ClN3O4 — CID 58722897
9-chloro-8-nitro-4-pentyl-3,6-dihydro-2H-pyrido[2,3-g][1,4]benzoxazin-7-one (PubChem CID 58722897) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is 9-chloro-8-nitro-4-pentyl-3,6-dihydro-2H-pyrido[2,3-g][1,4]benzoxazin-7-one.
| Compound Name | 9-chloro-8-nitro-4-pentyl-3,6-dihydro-2H-pyrido[2,3-g][1,4]benzoxazin-7-one |
|---|---|
| PubChem CID | 58722897 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 9-chloro-8-nitro-4-pentyl-3,6-dihydro-2H-pyrido[2,3-g][1,4]benzoxazin-7-one |
| SMILES | CCCCCN1CCOc2cc3c(Cl)c([N+](=O)[O-])c(=O)[nH]c3cc21 |
| InChI | InChI=1S/C16H18ClN3O4/c1-2-3-4-5-19-6-7-24-13-8-10-11(9-12(13)19)18-16(21)15(14(10)17)20(22)23/h8-9H,2-7H2,1H3,(H,18,21) |
| InChIKey | IKSALYVUIHEGGP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|