About 3a,7a-dihydro-1H-benzotriazole
3a,7a-dihydro-1H-benzotriazole (PubChem CID 58722971) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 3a,7a-dihydro-1H-benzotriazole.
Molecular Properties
| Compound Name | 3a,7a-dihydro-1H-benzotriazole |
| PubChem CID | 58722971 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 3a,7a-dihydro-1H-benzotriazole |
| SMILES | C1=CC2N=NNC2C=C1 |
| InChI | InChI=1S/C6H7N3/c1-2-4-6-5(3-1)7-9-8-6/h1-6H,(H,7,8) |
| InChIKey | PQTHCGTUISWTHV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3a,7a-dihydro-1H-benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,7a-dihydro-1H-benzotriazole?
The IUPAC name of 3a,7a-dihydro-1H-benzotriazole (CID 58722971) is 3a,7a-dihydro-1H-benzotriazole.
What is the SMILES notation for 3a,7a-dihydro-1H-benzotriazole?
The canonical SMILES for 3a,7a-dihydro-1H-benzotriazole is C1=CC2N=NNC2C=C1.
What is the InChIKey of 3a,7a-dihydro-1H-benzotriazole?
The InChIKey is PQTHCGTUISWTHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c1-2-4-6-5(3-1)7-9-8-6/h1-6H,(H,7,8).
What are the key properties of 3a,7a-dihydro-1H-benzotriazole?
3a,7a-dihydro-1H-benzotriazole has a molecular weight of 121.14 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,7a-dihydro-1H-benzotriazole is sourced from PubChem (CID 58722971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).