C25H29N3O3 — CID 58723973
methyl (2R,3S)-3-(1H-indol-3-yl)-2-[(4-phenylpiperidine-1-carbonyl)amino]butanoate (PubChem CID 58723973) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is methyl (2R,3S)-3-(1H-indol-3-yl)-2-[(4-phenylpiperidine-1-carbonyl)amino]butanoate.
| Compound Name | methyl (2R,3S)-3-(1H-indol-3-yl)-2-[(4-phenylpiperidine-1-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 58723973 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | methyl (2R,3S)-3-(1H-indol-3-yl)-2-[(4-phenylpiperidine-1-carbonyl)amino]butanoate |
| SMILES | COC(=O)[C@H](NC(=O)N1CCC(c2ccccc2)CC1)[C@@H](C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H29N3O3/c1-17(21-16-26-22-11-7-6-10-20(21)22)23(24(29)31-2)27-25(30)28-14-12-19(13-15-28)18-8-4-3-5-9-18/h3-11,16-17,19,23,26H,12-15H2,1-2H3,(H,27,30)/t17-,23+/m0/s1 |
| InChIKey | FRKHEBGCIZGMQP-GAJHUEQPSA-N |
| XLogP | 4.40 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |