C7H10N2S — CID 58724330
2,5,8,8a-tetrahydro-1H-imidazo[1,5-a]pyridine-3-thione (PubChem CID 58724330) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 2,5,8,8a-tetrahydro-1H-imidazo[1,5-a]pyridine-3-thione.
| Compound Name | 2,5,8,8a-tetrahydro-1H-imidazo[1,5-a]pyridine-3-thione |
|---|---|
| PubChem CID | 58724330 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2,5,8,8a-tetrahydro-1H-imidazo[1,5-a]pyridine-3-thione |
| SMILES | S=C1NCC2CC=CCN12 |
| InChI | InChI=1S/C7H10N2S/c10-7-8-5-6-3-1-2-4-9(6)7/h1-2,6H,3-5H2,(H,8,10) |
| InChIKey | DNCURGQYAAPEDH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|