C20H27BN2O — CID 58724351
[2-(2-aminoethyl)-4,6-diphenylpiperidin-1-yl]-methylborinic acid (PubChem CID 58724351) has the molecular formula C20H27BN2O and a molecular weight of 322.26 g/mol. Its IUPAC name is [2-(2-aminoethyl)-4,6-diphenylpiperidin-1-yl]-methylborinic acid.
| Compound Name | [2-(2-aminoethyl)-4,6-diphenylpiperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 58724351 |
| Molecular Formula | C20H27BN2O |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | [2-(2-aminoethyl)-4,6-diphenylpiperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1C(CCN)CC(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C20H27BN2O/c1-21(24)23-19(12-13-22)14-18(16-8-4-2-5-9-16)15-20(23)17-10-6-3-7-11-17/h2-11,18-20,24H,12-15,22H2,1H3 |
| InChIKey | JTUDIEXLNGFGAX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|