C7H10N2O — CID 58724369
2,5,6,8a-tetrahydro-1H-imidazo[1,5-a]pyridin-3-one (PubChem CID 58724369) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 2,5,6,8a-tetrahydro-1H-imidazo[1,5-a]pyridin-3-one.
| Compound Name | 2,5,6,8a-tetrahydro-1H-imidazo[1,5-a]pyridin-3-one |
|---|---|
| PubChem CID | 58724369 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2,5,6,8a-tetrahydro-1H-imidazo[1,5-a]pyridin-3-one |
| SMILES | O=C1NCC2C=CCCN12 |
| InChI | InChI=1S/C7H10N2O/c10-7-8-5-6-3-1-2-4-9(6)7/h1,3,6H,2,4-5H2,(H,8,10) |
| InChIKey | PNNHZSUVYJLGST-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|