C8H14N2 — CID 58724385
2,3,4,4a,7,8-hexahydro-1H-pyrido[1,2-c]pyrimidine (PubChem CID 58724385) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2,3,4,4a,7,8-hexahydro-1H-pyrido[1,2-c]pyrimidine.
| Compound Name | 2,3,4,4a,7,8-hexahydro-1H-pyrido[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 58724385 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2,3,4,4a,7,8-hexahydro-1H-pyrido[1,2-c]pyrimidine |
| SMILES | C1=CC2CCNCN2CC1 |
| InChI | InChI=1S/C8H14N2/c1-2-6-10-7-9-5-4-8(10)3-1/h1,3,8-9H,2,4-7H2 |
| InChIKey | AJJOVKWEHNAVLF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|