C20H24BrN3O — CID 58724589
(4a-bromo-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(1-methyl-5-phenylpyrazol-4-yl)methanone (PubChem CID 58724589) has the molecular formula C20H24BrN3O and a molecular weight of 402.34 g/mol. Its IUPAC name is (4a-bromo-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(1-methyl-5-phenylpyrazol-4-yl)methanone.
| Compound Name | (4a-bromo-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(1-methyl-5-phenylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 58724589 |
| Molecular Formula | C20H24BrN3O |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (4a-bromo-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(1-methyl-5-phenylpyrazol-4-yl)methanone |
| SMILES | Cn1ncc(C(=O)N2CCC3(Br)CCCCC3C2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H24BrN3O/c1-23-18(15-7-3-2-4-8-15)17(13-22-23)19(25)24-12-11-20(21)10-6-5-9-16(20)14-24/h2-4,7-8,13,16H,5-6,9-12,14H2,1H3 |
| InChIKey | OXORGWZUGLFNTK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|