About 5-amino-4,4-dimethylpiperidine-2-carboxylic acid
5-amino-4,4-dimethylpiperidine-2-carboxylic acid (PubChem CID 58725270) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 5-amino-4,4-dimethylpiperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-4,4-dimethylpiperidine-2-carboxylic acid |
| PubChem CID | 58725270 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 5-amino-4,4-dimethylpiperidine-2-carboxylic acid |
| SMILES | CC1(C)CC(C(=O)O)NCC1N |
| InChI | InChI=1S/C8H16N2O2/c1-8(2)3-5(7(11)12)10-4-6(8)9/h5-6,10H,3-4,9H2,1-2H3,(H,11,12) |
| InChIKey | FHIAAAHAJHZZHF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-4,4-dimethylpiperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4,4-dimethylpiperidine-2-carboxylic acid?
The IUPAC name of 5-amino-4,4-dimethylpiperidine-2-carboxylic acid (CID 58725270) is 5-amino-4,4-dimethylpiperidine-2-carboxylic acid.
What is the SMILES notation for 5-amino-4,4-dimethylpiperidine-2-carboxylic acid?
The canonical SMILES for 5-amino-4,4-dimethylpiperidine-2-carboxylic acid is CC1(C)CC(C(=O)O)NCC1N.
What is the InChIKey of 5-amino-4,4-dimethylpiperidine-2-carboxylic acid?
The InChIKey is FHIAAAHAJHZZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-8(2)3-5(7(11)12)10-4-6(8)9/h5-6,10H,3-4,9H2,1-2H3,(H,11,12).
What are the key properties of 5-amino-4,4-dimethylpiperidine-2-carboxylic acid?
5-amino-4,4-dimethylpiperidine-2-carboxylic acid has a molecular weight of 172.23 g/mol, XLogP of -0.21, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4,4-dimethylpiperidine-2-carboxylic acid is sourced from PubChem (CID 58725270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).