5-amino-4,4-dimethylpiperidine-2-carboxylic acid

C8H16N2O2 — CID 58725270

IUPAC5-amino-4,4-dimethylpiperidine-2-carboxylic acid
SMILESCC1(C)CC(C(=O)O)NCC1N
InChIInChI=1S/C8H16N2O2/c1-8(2)3-5(7(11)12)10-4-6(8)9/h5-6,10H,3-4,9H2,1-2H3,(H,11,12)
InChIKeyFHIAAAHAJHZZHF-UHFFFAOYSA-N
MW172.23 g/mol
LogP-0.21
Rot. Bonds1

About 5-amino-4,4-dimethylpiperidine-2-carboxylic acid

5-amino-4,4-dimethylpiperidine-2-carboxylic acid (PubChem CID 58725270) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 5-amino-4,4-dimethylpiperidine-2-carboxylic acid.

Molecular Properties

Compound Name5-amino-4,4-dimethylpiperidine-2-carboxylic acid
PubChem CID58725270
Molecular FormulaC8H16N2O2
Molecular Weight172.23 g/mol
Exact Mass172.12
IUPAC Name5-amino-4,4-dimethylpiperidine-2-carboxylic acid
SMILESCC1(C)CC(C(=O)O)NCC1N
InChIInChI=1S/C8H16N2O2/c1-8(2)3-5(7(11)12)10-4-6(8)9/h5-6,10H,3-4,9H2,1-2H3,(H,11,12)
InChIKeyFHIAAAHAJHZZHF-UHFFFAOYSA-N
XLogP-0.21
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.23
LogP ≤ 5-0.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 5-amino-4,4-dimethylpiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-4,4-dimethylpiperidine-2-carboxylic acid?
The IUPAC name of 5-amino-4,4-dimethylpiperidine-2-carboxylic acid (CID 58725270) is 5-amino-4,4-dimethylpiperidine-2-carboxylic acid.
What is the SMILES notation for 5-amino-4,4-dimethylpiperidine-2-carboxylic acid?
The canonical SMILES for 5-amino-4,4-dimethylpiperidine-2-carboxylic acid is CC1(C)CC(C(=O)O)NCC1N.
What is the InChIKey of 5-amino-4,4-dimethylpiperidine-2-carboxylic acid?
The InChIKey is FHIAAAHAJHZZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-8(2)3-5(7(11)12)10-4-6(8)9/h5-6,10H,3-4,9H2,1-2H3,(H,11,12).
What are the key properties of 5-amino-4,4-dimethylpiperidine-2-carboxylic acid?
5-amino-4,4-dimethylpiperidine-2-carboxylic acid has a molecular weight of 172.23 g/mol, XLogP of -0.21, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4,4-dimethylpiperidine-2-carboxylic acid is sourced from PubChem (CID 58725270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).