C28H36F2N4O5 — CID 58726475
(3S,6S,9S,12R)-6-ethyl-9-[(E)-7-fluoro-6-oxohept-4-enyl]-3-[(3-fluorophenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58726475) has the molecular formula C28H36F2N4O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is (3S,6S,9S,12R)-6-ethyl-9-[(E)-7-fluoro-6-oxohept-4-enyl]-3-[(3-fluorophenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-6-ethyl-9-[(E)-7-fluoro-6-oxohept-4-enyl]-3-[(3-fluorophenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726475 |
| Molecular Formula | C28H36F2N4O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | (3S,6S,9S,12R)-6-ethyl-9-[(E)-7-fluoro-6-oxohept-4-enyl]-3-[(3-fluorophenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCC/C=C/C(=O)CF)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2cccc(F)c2)NC1=O |
| InChI | InChI=1S/C28H36F2N4O5/c1-3-28(2)27(39)32-22(16-18-9-7-10-19(30)15-18)26(38)34-14-8-13-23(34)25(37)31-21(24(36)33-28)12-6-4-5-11-20(35)17-29/h5,7,9-11,15,21-23H,3-4,6,8,12-14,16-17H2,1-2H3,(H,31,37)(H,32,39)(H,33,36)/b11-5+/t21-,22-,23+,28-/m0/s1 |
| InChIKey | ULSFAWYRPIEFIB-CGLKZGAGSA-N |
| XLogP | 1.89 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|