C33H44N4O7 — CID 58726680
(2R)-1-[2-[[(2S)-2-[[(2S)-2-amino-6-benzoyloxyhexanoyl]amino]-2-methylbutanoyl]amino]-3-(4-methylphenyl)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 58726680) has the molecular formula C33H44N4O7 and a molecular weight of 608.74 g/mol. Its IUPAC name is (2R)-1-[2-[[(2S)-2-[[(2S)-2-amino-6-benzoyloxyhexanoyl]amino]-2-methylbutanoyl]amino]-3-(4-methylphenyl)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-[[(2S)-2-[[(2S)-2-amino-6-benzoyloxyhexanoyl]amino]-2-methylbutanoyl]amino]-3-(4-methylphenyl)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58726680 |
| Molecular Formula | C33H44N4O7 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | (2R)-1-[2-[[(2S)-2-[[(2S)-2-amino-6-benzoyloxyhexanoyl]amino]-2-methylbutanoyl]amino]-3-(4-methylphenyl)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC[C@](C)(NC(=O)[C@@H](N)CCCCOC(=O)c1ccccc1)C(=O)NC(Cc1ccc(C)cc1)C(=O)N1CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C33H44N4O7/c1-4-33(3,36-28(38)25(34)13-8-9-20-44-31(42)24-11-6-5-7-12-24)32(43)35-26(21-23-17-15-22(2)16-18-23)29(39)37-19-10-14-27(37)30(40)41/h5-7,11-12,15-18,25-27H,4,8-10,13-14,19-21,34H2,1-3H3,(H,35,43)(H,36,38)(H,40,41)/t25-,26?,27+,33-/m0/s1 |
| InChIKey | VKTGDFFGQQORFN-FXAARSPNSA-N |
| XLogP | 2.74 |
| TPSA | 168.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|