About N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide (PubChem CID 58727283) has the molecular formula C26H26FN3O2S
and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide.
Molecular Properties
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide |
| PubChem CID | 58727283 |
| Molecular Formula | C26H26FN3O2S |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide |
| SMILES | CCCOc1cc(F)ccc1-c1cccc(C(=O)NCCCNc2nsc3ccccc23)c1 |
| InChI | InChI=1S/C26H26FN3O2S/c1-2-15-32-23-17-20(27)11-12-21(23)18-7-5-8-19(16-18)26(31)29-14-6-13-28-25-22-9-3-4-10-24(22)33-30-25/h3-5,7-12,16-17H,2,6,13-15H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | IZVLEDLQYQQEAM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide?
The IUPAC name of N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide (CID 58727283) is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide.
What is the SMILES notation for N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide?
The canonical SMILES for N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide is CCCOc1cc(F)ccc1-c1cccc(C(=O)NCCCNc2nsc3ccccc23)c1.
What is the InChIKey of N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide?
The InChIKey is IZVLEDLQYQQEAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26FN3O2S/c1-2-15-32-23-17-20(27)11-12-21(23)18-7-5-8-19(16-18)26(31)29-14-6-13-28-25-22-9-3-4-10-24(22)33-30-25/h3-5,7-12,16-17H,2,6,13-15H2,1H3,(H,28,30)(H,29,31).
What are the key properties of N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide?
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide has a molecular weight of 463.58 g/mol, XLogP of 6.12, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-fluoro-2-propoxyphenyl)benzamide is sourced from PubChem (CID 58727283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).