About [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate
[1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate (PubChem CID 58727313) has the molecular formula C30H28N2O3
and a molecular weight of 464.57 g/mol. Its IUPAC name is [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate.
Molecular Properties
| Compound Name | [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate |
| PubChem CID | 58727313 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OC(COc2cccc3ccccc23)CN(C)C2=NCc3ccccc32)c1 |
| InChI | InChI=1S/C30H28N2O3/c1-21-9-7-13-23(17-21)30(33)35-25(19-32(2)29-27-15-6-4-11-24(27)18-31-29)20-34-28-16-8-12-22-10-3-5-14-26(22)28/h3-17,25H,18-20H2,1-2H3 |
| InChIKey | JAJXUSKRQBRUBS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate?
The IUPAC name of [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate (CID 58727313) is [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate.
What is the SMILES notation for [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate?
The canonical SMILES for [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate is Cc1cccc(C(=O)OC(COc2cccc3ccccc23)CN(C)C2=NCc3ccccc32)c1.
What is the InChIKey of [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate?
The InChIKey is JAJXUSKRQBRUBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28N2O3/c1-21-9-7-13-23(17-21)30(33)35-25(19-32(2)29-27-15-6-4-11-24(27)18-31-29)20-34-28-16-8-12-22-10-3-5-14-26(22)28/h3-17,25H,18-20H2,1-2H3.
What are the key properties of [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate?
[1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate has a molecular weight of 464.57 g/mol, XLogP of 5.64, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3H-isoindol-1-yl(methyl)amino]-3-naphthalen-1-yloxypropan-2-yl] 3-methylbenzoate is sourced from PubChem (CID 58727313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).