C22H24ClFN2O3 — CID 58727369
(6R)-2-(4-chloro-3-methoxyphenyl)-6-(3-fluoro-4-methoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-one (PubChem CID 58727369) has the molecular formula C22H24ClFN2O3 and a molecular weight of 418.90 g/mol. Its IUPAC name is (6R)-2-(4-chloro-3-methoxyphenyl)-6-(3-fluoro-4-methoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-one.
| Compound Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-(3-fluoro-4-methoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-one |
|---|---|
| PubChem CID | 58727369 |
| Molecular Formula | C22H24ClFN2O3 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-(3-fluoro-4-methoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-one |
| SMILES | COc1ccc([C@H]2CC(=O)CC3CN(c4ccc(Cl)c(OC)c4)CCN32)cc1F |
| InChI | InChI=1S/C22H24ClFN2O3/c1-28-21-6-3-14(9-19(21)24)20-12-17(27)10-16-13-25(7-8-26(16)20)15-4-5-18(23)22(11-15)29-2/h3-6,9,11,16,20H,7-8,10,12-13H2,1-2H3/t16?,20-/m1/s1 |
| InChIKey | TZWUFPYBLWHPTF-OTOKDRCRSA-N |
| XLogP | 4.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |