About N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine
N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 58727543) has the molecular formula C19H20N4S
and a molecular weight of 336.46 g/mol. Its IUPAC name is N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 58727543 |
| Molecular Formula | C19H20N4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | [C-]#[N+]c1sc2nc(-c3ccc(C)cc3)nc(N(CC)CC)c2c1C |
| InChI | InChI=1S/C19H20N4S/c1-6-23(7-2)17-15-13(4)18(20-5)24-19(15)22-16(21-17)14-10-8-12(3)9-11-14/h8-11H,6-7H2,1-4H3 |
| InChIKey | JLQKRXCYUFUYPJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 33.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine (CID 58727543) is N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine is [C-]#[N+]c1sc2nc(-c3ccc(C)cc3)nc(N(CC)CC)c2c1C.
What is the InChIKey of N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is JLQKRXCYUFUYPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4S/c1-6-23(7-2)17-15-13(4)18(20-5)24-19(15)22-16(21-17)14-10-8-12(3)9-11-14/h8-11H,6-7H2,1-4H3.
What are the key properties of N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine?
N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 336.46 g/mol, XLogP of 5.37, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-6-isocyano-5-methyl-2-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 58727543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).