C31H38N6 — CID 58727857
(Z)-N-isocyano-1-[4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]ethanimine (PubChem CID 58727857) has the molecular formula C31H38N6 and a molecular weight of 494.69 g/mol. Its IUPAC name is (Z)-N-isocyano-1-[4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]ethanimine.
| Compound Name | (Z)-N-isocyano-1-[4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]ethanimine |
|---|---|
| PubChem CID | 58727857 |
| Molecular Formula | C31H38N6 |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | (Z)-N-isocyano-1-[4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]ethanimine |
| SMILES | [C-]#[N+]/N=C(/C)N1CCC(CCN2[C@@H]3CC[C@H]2CC(n2c(C)nc4ccccc42)C3)(c2ccccc2)CC1 |
| InChI | InChI=1S/C31H38N6/c1-23-33-29-11-7-8-12-30(29)37(23)28-21-26-13-14-27(22-28)36(26)20-17-31(25-9-5-4-6-10-25)15-18-35(19-16-31)24(2)34-32-3/h4-12,26-28H,13-22H2,1-2H3/b34-24-/t26-,27+,28? |
| InChIKey | RCRFFXYOIPHKCS-WZLVNTENSA-N |
| XLogP | 6.19 |
| TPSA | 41.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|