C8H5F4NO4S — CID 58727995
2-fluoro-4-(trifluoromethylsulfonylamino)benzoic acid (PubChem CID 58727995) has the molecular formula C8H5F4NO4S and a molecular weight of 287.19 g/mol. Its IUPAC name is 2-fluoro-4-(trifluoromethylsulfonylamino)benzoic acid.
| Compound Name | 2-fluoro-4-(trifluoromethylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 58727995 |
| Molecular Formula | C8H5F4NO4S |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 2-fluoro-4-(trifluoromethylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)C(F)(F)F)cc1F |
| InChI | InChI=1S/C8H5F4NO4S/c9-6-3-4(1-2-5(6)7(14)15)13-18(16,17)8(10,11)12/h1-3,13H,(H,14,15) |
| InChIKey | SVJYRPSOAPHJSS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |