C30H32N6O4 — CID 58729034
4-tert-butyl-N-[2-methyl-3-[4-methyl-6-[4-(methylamino)-3-nitroanilino]-5-oxopyrazin-2-yl]phenyl]benzamide (PubChem CID 58729034) has the molecular formula C30H32N6O4 and a molecular weight of 540.62 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-methyl-3-[4-methyl-6-[4-(methylamino)-3-nitroanilino]-5-oxopyrazin-2-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-methyl-3-[4-methyl-6-[4-(methylamino)-3-nitroanilino]-5-oxopyrazin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 58729034 |
| Molecular Formula | C30H32N6O4 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 4-tert-butyl-N-[2-methyl-3-[4-methyl-6-[4-(methylamino)-3-nitroanilino]-5-oxopyrazin-2-yl]phenyl]benzamide |
| SMILES | CNc1ccc(Nc2nc(-c3cccc(NC(=O)c4ccc(C(C)(C)C)cc4)c3C)cn(C)c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H32N6O4/c1-18-22(8-7-9-23(18)34-28(37)19-10-12-20(13-11-19)30(2,3)4)25-17-35(6)29(38)27(33-25)32-21-14-15-24(31-5)26(16-21)36(39)40/h7-17,31H,1-6H3,(H,32,33)(H,34,37) |
| InChIKey | VXATUSWJXSATSV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|