C23H9NO3 — CID 58729225
15,17-dioxo-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11(21),12,14(22),18-decaene-5-carbonitrile (PubChem CID 58729225) has the molecular formula C23H9NO3 and a molecular weight of 347.33 g/mol. Its IUPAC name is 15,17-dioxo-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11(21),12,14(22),18-decaene-5-carbonitrile.
| Compound Name | 15,17-dioxo-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11(21),12,14(22),18-decaene-5-carbonitrile |
|---|---|
| PubChem CID | 58729225 |
| Molecular Formula | C23H9NO3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 15,17-dioxo-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11(21),12,14(22),18-decaene-5-carbonitrile |
| SMILES | N#Cc1ccc2c3ccc4c5c(ccc(c6cccc1c62)c53)C(=O)OC4=O |
| InChI | InChI=1S/C23H9NO3/c24-10-11-4-5-14-16-7-9-18-21-17(22(25)27-23(18)26)8-6-15(20(16)21)13-3-1-2-12(11)19(13)14/h1-9H |
| InChIKey | BLZFUAOYTUTRJW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|