About (3E)-penta-1,3-diene-3-diazonium
(3E)-penta-1,3-diene-3-diazonium (PubChem CID 58729376) has the molecular formula C5H7N2+
and a molecular weight of 95.12 g/mol. Its IUPAC name is (3E)-penta-1,3-diene-3-diazonium.
Molecular Properties
| Compound Name | (3E)-penta-1,3-diene-3-diazonium |
| PubChem CID | 58729376 |
| Molecular Formula | C5H7N2+ |
| Molecular Weight | 95.12 g/mol |
| Exact Mass | 95.06 |
| IUPAC Name | (3E)-penta-1,3-diene-3-diazonium |
| SMILES | C=C/C(=C\C)[N+]#N |
| InChI | InChI=1S/C5H7N2/c1-3-5(4-2)7-6/h3-4H,1H2,2H3/q+1/b5-4+ |
| InChIKey | DKPDVISNFSJGGM-SNAWJCMRSA-N |
| XLogP | 1.93 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-penta-1,3-diene-3-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-penta-1,3-diene-3-diazonium?
The IUPAC name of (3E)-penta-1,3-diene-3-diazonium (CID 58729376) is (3E)-penta-1,3-diene-3-diazonium.
What is the SMILES notation for (3E)-penta-1,3-diene-3-diazonium?
The canonical SMILES for (3E)-penta-1,3-diene-3-diazonium is C=C/C(=C\C)[N+]#N.
What is the InChIKey of (3E)-penta-1,3-diene-3-diazonium?
The InChIKey is DKPDVISNFSJGGM-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H7N2/c1-3-5(4-2)7-6/h3-4H,1H2,2H3/q+1/b5-4+.
What are the key properties of (3E)-penta-1,3-diene-3-diazonium?
(3E)-penta-1,3-diene-3-diazonium has a molecular weight of 95.12 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-penta-1,3-diene-3-diazonium is sourced from PubChem (CID 58729376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).