C23H30O2 — CID 58729408
3-[(1E,3E,5E,7E,9E)-3,7-dimethyldodeca-1,3,5,7,9,11-hexaenyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 58729408) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is 3-[(1E,3E,5E,7E,9E)-3,7-dimethyldodeca-1,3,5,7,9,11-hexaenyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 3-[(1E,3E,5E,7E,9E)-3,7-dimethyldodeca-1,3,5,7,9,11-hexaenyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 58729408 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3-[(1E,3E,5E,7E,9E)-3,7-dimethyldodeca-1,3,5,7,9,11-hexaenyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | C=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(=O)C(O)CC1(C)C |
| InChI | InChI=1S/C23H30O2/c1-7-8-9-11-17(2)12-10-13-18(3)14-15-20-19(4)22(25)21(24)16-23(20,5)6/h7-15,21,24H,1,16H2,2-6H3/b9-8+,12-10+,15-14+,17-11+,18-13+ |
| InChIKey | WBRVVSVKHDYFJL-DHELZGRASA-N |
| XLogP | 5.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|