About 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione
3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione (PubChem CID 58729945) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione.
Molecular Properties
| Compound Name | 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione |
| PubChem CID | 58729945 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione |
| SMILES | O=C1OC(=O)C23CC=C(CC12)C3 |
| InChI | InChI=1S/C9H8O3/c10-7-6-3-5-1-2-9(6,4-5)8(11)12-7/h1,6H,2-4H2 |
| InChIKey | OJTQFVSZGJIYBS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione?
The IUPAC name of 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione (CID 58729945) is 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione.
What is the SMILES notation for 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione?
The canonical SMILES for 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione is O=C1OC(=O)C23CC=C(CC12)C3.
What is the InChIKey of 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione?
The InChIKey is OJTQFVSZGJIYBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c10-7-6-3-5-1-2-9(6,4-5)8(11)12-7/h1,6H,2-4H2.
What are the key properties of 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione?
3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione has a molecular weight of 164.16 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxatricyclo[5.2.1.01,5]dec-7-ene-2,4-dione is sourced from PubChem (CID 58729945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).