C16H16N2O3S — CID 58730239
3-[(8-hydroxyquinolin-5-yl)methylsulfanyl]-2-(prop-2-ynylamino)propanoic acid (PubChem CID 58730239) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-[(8-hydroxyquinolin-5-yl)methylsulfanyl]-2-(prop-2-ynylamino)propanoic acid.
| Compound Name | 3-[(8-hydroxyquinolin-5-yl)methylsulfanyl]-2-(prop-2-ynylamino)propanoic acid |
|---|---|
| PubChem CID | 58730239 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-[(8-hydroxyquinolin-5-yl)methylsulfanyl]-2-(prop-2-ynylamino)propanoic acid |
| SMILES | C#CCNC(CSCc1ccc(O)c2ncccc12)C(=O)O |
| InChI | InChI=1S/C16H16N2O3S/c1-2-7-17-13(16(20)21)10-22-9-11-5-6-14(19)15-12(11)4-3-8-18-15/h1,3-6,8,13,17,19H,7,9-10H2,(H,20,21) |
| InChIKey | QIWBJHMWXALHQX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|