C25H48N2SiSn — CID 58730931
tert-butyl-dimethyl-(5-tributylstannyl-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)silane (PubChem CID 58730931) has the molecular formula C25H48N2SiSn and a molecular weight of 523.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-(5-tributylstannyl-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)silane.
| Compound Name | tert-butyl-dimethyl-(5-tributylstannyl-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)silane |
|---|---|
| PubChem CID | 58730931 |
| Molecular Formula | C25H48N2SiSn |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | tert-butyl-dimethyl-(5-tributylstannyl-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc2c(c1)CCN2[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H21N2Si.3C4H9.Sn/c1-13(2,3)16(4,5)15-10-8-11-7-6-9-14-12(11)15;3*1-3-4-2;/h7,9H,8,10H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | UUNGGGRWNAZGQC-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|