About 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde
1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde (PubChem CID 58730934) has the molecular formula C14H22N2OSi
and a molecular weight of 262.43 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde.
Molecular Properties
| Compound Name | 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde |
| PubChem CID | 58730934 |
| Molecular Formula | C14H22N2OSi |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)N1CCc2cc(C=O)cnc21 |
| InChI | InChI=1S/C14H22N2OSi/c1-14(2,3)18(4,5)16-7-6-12-8-11(10-17)9-15-13(12)16/h8-10H,6-7H2,1-5H3 |
| InChIKey | QAUVHWMJTBWIER-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde?
The IUPAC name of 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde (CID 58730934) is 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde.
What is the SMILES notation for 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde?
The canonical SMILES for 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde is CC(C)(C)[Si](C)(C)N1CCc2cc(C=O)cnc21.
What is the InChIKey of 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde?
The InChIKey is QAUVHWMJTBWIER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2OSi/c1-14(2,3)18(4,5)16-7-6-12-8-11(10-17)9-15-13(12)16/h8-10H,6-7H2,1-5H3.
What are the key properties of 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde?
1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde has a molecular weight of 262.43 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[tert-butyl(dimethyl)silyl]-2,3-dihydropyrrolo[2,3-b]pyridine-5-carbaldehyde is sourced from PubChem (CID 58730934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).