C20H21ClN2O2S — CID 58731292
N-[3-[(1R)-1-(4-chlorophenyl)-1-cyclopropylethyl]-1H-indol-7-yl]methanesulfonamide (PubChem CID 58731292) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is N-[3-[(1R)-1-(4-chlorophenyl)-1-cyclopropylethyl]-1H-indol-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1R)-1-(4-chlorophenyl)-1-cyclopropylethyl]-1H-indol-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 58731292 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[3-[(1R)-1-(4-chlorophenyl)-1-cyclopropylethyl]-1H-indol-7-yl]methanesulfonamide |
| SMILES | C[C@@](c1ccc(Cl)cc1)(c1c[nH]c2c(NS(C)(=O)=O)cccc12)C1CC1 |
| InChI | InChI=1S/C20H21ClN2O2S/c1-20(13-6-7-13,14-8-10-15(21)11-9-14)17-12-22-19-16(17)4-3-5-18(19)23-26(2,24)25/h3-5,8-13,22-23H,6-7H2,1-2H3/t20-/m1/s1 |
| InChIKey | JDADMHQCJBMVIG-HXUWFJFHSA-N |
| XLogP | 4.91 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |