C20H21FN2O2S — CID 58731329
N-[3-[(1S)-1-cyclopropyl-1-(2-fluorophenyl)ethyl]-1H-indol-7-yl]methanesulfonamide (PubChem CID 58731329) has the molecular formula C20H21FN2O2S and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[3-[(1S)-1-cyclopropyl-1-(2-fluorophenyl)ethyl]-1H-indol-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1S)-1-cyclopropyl-1-(2-fluorophenyl)ethyl]-1H-indol-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 58731329 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[3-[(1S)-1-cyclopropyl-1-(2-fluorophenyl)ethyl]-1H-indol-7-yl]methanesulfonamide |
| SMILES | C[C@@](c1ccccc1F)(c1c[nH]c2c(NS(C)(=O)=O)cccc12)C1CC1 |
| InChI | InChI=1S/C20H21FN2O2S/c1-20(13-10-11-13,15-7-3-4-8-17(15)21)16-12-22-19-14(16)6-5-9-18(19)23-26(2,24)25/h3-9,12-13,22-23H,10-11H2,1-2H3/t20-/m1/s1 |
| InChIKey | OWCOWTGBEVDFKW-HXUWFJFHSA-N |
| XLogP | 4.39 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |