C35H66 — CID 58731385
2-(4-hexylcyclohexyl)-1,3-dimethyl-5-[2-[4-methyl-3,5-di(propan-2-yl)cyclohexyl]ethyl]cyclohexane (PubChem CID 58731385) has the molecular formula C35H66 and a molecular weight of 486.91 g/mol. Its IUPAC name is 2-(4-hexylcyclohexyl)-1,3-dimethyl-5-[2-[4-methyl-3,5-di(propan-2-yl)cyclohexyl]ethyl]cyclohexane.
| Compound Name | 2-(4-hexylcyclohexyl)-1,3-dimethyl-5-[2-[4-methyl-3,5-di(propan-2-yl)cyclohexyl]ethyl]cyclohexane |
|---|---|
| PubChem CID | 58731385 |
| Molecular Formula | C35H66 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.52 |
| IUPAC Name | 2-(4-hexylcyclohexyl)-1,3-dimethyl-5-[2-[4-methyl-3,5-di(propan-2-yl)cyclohexyl]ethyl]cyclohexane |
| SMILES | CCCCCCC1CCC(C2C(C)CC(CCC3CC(C(C)C)C(C)C(C(C)C)C3)CC2C)CC1 |
| InChI | InChI=1S/C35H66/c1-9-10-11-12-13-29-16-18-32(19-17-29)35-26(6)20-30(21-27(35)7)14-15-31-22-33(24(2)3)28(8)34(23-31)25(4)5/h24-35H,9-23H2,1-8H3 |
| InChIKey | LRYXQTDKOAIEMH-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|