C22H25FN4O — CID 58731665
6-(4-cyano-2-fluoroanilino)-N-(cyclopentylmethyl)-4-propan-2-ylpyridine-3-carboxamide (PubChem CID 58731665) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is 6-(4-cyano-2-fluoroanilino)-N-(cyclopentylmethyl)-4-propan-2-ylpyridine-3-carboxamide.
| Compound Name | 6-(4-cyano-2-fluoroanilino)-N-(cyclopentylmethyl)-4-propan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 58731665 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 6-(4-cyano-2-fluoroanilino)-N-(cyclopentylmethyl)-4-propan-2-ylpyridine-3-carboxamide |
| SMILES | CC(C)c1cc(Nc2ccc(C#N)cc2F)ncc1C(=O)NCC1CCCC1 |
| InChI | InChI=1S/C22H25FN4O/c1-14(2)17-10-21(27-20-8-7-16(11-24)9-19(20)23)25-13-18(17)22(28)26-12-15-5-3-4-6-15/h7-10,13-15H,3-6,12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | KYBGFAXHGVHLQJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |