C13H20O16 — CID 58731861
3-[[2-(carboxymethyl)-4-hydroperoxy-2,3-dihydroxybutyl]peroxymethoxycarbonyl]-2,3-dihydroxypentanedioic acid (PubChem CID 58731861) has the molecular formula C13H20O16 and a molecular weight of 432.29 g/mol. Its IUPAC name is 3-[[2-(carboxymethyl)-4-hydroperoxy-2,3-dihydroxybutyl]peroxymethoxycarbonyl]-2,3-dihydroxypentanedioic acid.
| Compound Name | 3-[[2-(carboxymethyl)-4-hydroperoxy-2,3-dihydroxybutyl]peroxymethoxycarbonyl]-2,3-dihydroxypentanedioic acid |
|---|---|
| PubChem CID | 58731861 |
| Molecular Formula | C13H20O16 |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 3-[[2-(carboxymethyl)-4-hydroperoxy-2,3-dihydroxybutyl]peroxymethoxycarbonyl]-2,3-dihydroxypentanedioic acid |
| SMILES | O=C(O)CC(O)(COOCOC(=O)C(O)(CC(=O)O)C(O)C(=O)O)C(O)COO |
| InChI | InChI=1S/C13H20O16/c14-6(3-27-25)12(23,1-7(15)16)4-28-29-5-26-11(22)13(24,2-8(17)18)9(19)10(20)21/h6,9,14,19,23-25H,1-5H2,(H,15,16)(H,17,18)(H,20,21) |
| InChIKey | BDBASAPPSBPIJP-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 267.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|