C21H13N2S2Y- — CID 58732058
5-methylquinolino[2,3-b]acridin-12-ide-7,14-dithione;yttrium (PubChem CID 58732058) has the molecular formula C21H13N2S2Y- and a molecular weight of 446.39 g/mol. Its IUPAC name is 5-methylquinolino[2,3-b]acridin-12-ide-7,14-dithione;yttrium.
| Compound Name | 5-methylquinolino[2,3-b]acridin-12-ide-7,14-dithione;yttrium |
|---|---|
| PubChem CID | 58732058 |
| Molecular Formula | C21H13N2S2Y- |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.96 |
| IUPAC Name | 5-methylquinolino[2,3-b]acridin-12-ide-7,14-dithione;yttrium |
| SMILES | Cn1c2ccccc2c(=S)c2cc3[n-]c4ccccc4c(=S)c3cc21.[Y] |
| InChI | InChI=1S/C21H14N2S2.Y/c1-23-18-9-5-3-7-13(18)21(25)15-10-17-14(11-19(15)23)20(24)12-6-2-4-8-16(12)22-17;/h2-11H,1H3,(H,22,24);/p-1 |
| InChIKey | TZCYXSCJADXDSO-UHFFFAOYSA-M |
| XLogP | 6.05 |
| TPSA | 19.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|