C24H38N6O9 — CID 58732260
N'-[2-[2-[[4-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethylamino]-4-oxobutanoyl]amino]ethoxy]ethyl]-N-methylbutanediamide (PubChem CID 58732260) has the molecular formula C24H38N6O9 and a molecular weight of 554.60 g/mol. Its IUPAC name is N'-[2-[2-[[4-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethylamino]-4-oxobutanoyl]amino]ethoxy]ethyl]-N-methylbutanediamide.
| Compound Name | N'-[2-[2-[[4-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethylamino]-4-oxobutanoyl]amino]ethoxy]ethyl]-N-methylbutanediamide |
|---|---|
| PubChem CID | 58732260 |
| Molecular Formula | C24H38N6O9 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | N'-[2-[2-[[4-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethylamino]-4-oxobutanoyl]amino]ethoxy]ethyl]-N-methylbutanediamide |
| SMILES | CNC(=O)CCC(=O)NCCOCCNC(=O)CCC(=O)NCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H38N6O9/c1-25-18(31)2-3-19(32)26-9-14-38-15-10-27-20(33)4-5-21(34)28-11-16-39-17-12-29-22(35)8-13-30-23(36)6-7-24(30)37/h6-7H,2-5,8-17H2,1H3,(H,25,31)(H,26,32)(H,27,33)(H,28,34)(H,29,35) |
| InChIKey | KCERIECISBRYNT-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 201.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|