C8H13N5O — CID 58732562
(3R,4R)-3-(5-methyltetrazol-2-yl)-1-oxido-1-azoniabicyclo[2.2.1]heptane (PubChem CID 58732562) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is (3R,4R)-3-(5-methyltetrazol-2-yl)-1-oxido-1-azoniabicyclo[2.2.1]heptane.
| Compound Name | (3R,4R)-3-(5-methyltetrazol-2-yl)-1-oxido-1-azoniabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 58732562 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (3R,4R)-3-(5-methyltetrazol-2-yl)-1-oxido-1-azoniabicyclo[2.2.1]heptane |
| SMILES | Cc1nnn([C@H]2C[N+]3([O-])CC[C@@H]2C3)n1 |
| InChI | InChI=1S/C8H13N5O/c1-6-9-11-12(10-6)8-5-13(14)3-2-7(8)4-13/h7-8H,2-5H2,1H3/t7-,8+,13?/m1/s1 |
| InChIKey | LSHROYATRPTMNN-GXOFWPNESA-N |
| XLogP | -0.13 |
| TPSA | 66.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|