C35H35ClF5N5O5 — CID 58733045
N-[(2R)-3-(4-chlorophenyl)-1-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-oxopropan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide (PubChem CID 58733045) has the molecular formula C35H35ClF5N5O5 and a molecular weight of 736.14 g/mol. Its IUPAC name is N-[(2R)-3-(4-chlorophenyl)-1-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-oxopropan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide.
| Compound Name | N-[(2R)-3-(4-chlorophenyl)-1-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-oxopropan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide |
|---|---|
| PubChem CID | 58733045 |
| Molecular Formula | C35H35ClF5N5O5 |
| Molecular Weight | 736.14 g/mol |
| Exact Mass | 735.22 |
| IUPAC Name | N-[(2R)-3-(4-chlorophenyl)-1-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-oxopropan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide |
| SMILES | O=C(N[C@H](Cc1ccc(Cl)cc1)C(=O)N1CCC(Cn2cncn2)(C2CCCCC2)CC1)c1cc(=O)c2cc(OC(F)(F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C35H35ClF5N5O5/c36-24-8-6-22(7-9-24)16-27(32(49)45-14-12-33(13-15-45,19-46-21-42-20-43-46)23-4-2-1-3-5-23)44-31(48)30-18-28(47)26-17-25(10-11-29(26)50-30)51-35(40,41)34(37,38)39/h6-11,17-18,20-21,23,27H,1-5,12-16,19H2,(H,44,48)/t27-/m1/s1 |
| InChIKey | ZXGTUTYNEAPYHB-HHHXNRCGSA-N |
| XLogP | 6.80 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.14 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|