C19H15F3N2O3 — CID 58733230
2-[6-methyl-4-oxo-2-[2-(2,3,4-trifluorophenyl)ethyl]quinazolin-1-yl]acetic acid (PubChem CID 58733230) has the molecular formula C19H15F3N2O3 and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-[6-methyl-4-oxo-2-[2-(2,3,4-trifluorophenyl)ethyl]quinazolin-1-yl]acetic acid.
| Compound Name | 2-[6-methyl-4-oxo-2-[2-(2,3,4-trifluorophenyl)ethyl]quinazolin-1-yl]acetic acid |
|---|---|
| PubChem CID | 58733230 |
| Molecular Formula | C19H15F3N2O3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-[6-methyl-4-oxo-2-[2-(2,3,4-trifluorophenyl)ethyl]quinazolin-1-yl]acetic acid |
| SMILES | Cc1ccc2c(c1)c(=O)nc(CCc1ccc(F)c(F)c1F)n2CC(=O)O |
| InChI | InChI=1S/C19H15F3N2O3/c1-10-2-6-14-12(8-10)19(27)23-15(24(14)9-16(25)26)7-4-11-3-5-13(20)18(22)17(11)21/h2-3,5-6,8H,4,7,9H2,1H3,(H,25,26) |
| InChIKey | ZWHJIJUNDYDZIP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|