C26H27FN8O3 — CID 58733255
ethyl 1-[2-amino-6-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)anilino]pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate (PubChem CID 58733255) has the molecular formula C26H27FN8O3 and a molecular weight of 518.55 g/mol. Its IUPAC name is ethyl 1-[2-amino-6-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)anilino]pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate.
| Compound Name | ethyl 1-[2-amino-6-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)anilino]pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58733255 |
| Molecular Formula | C26H27FN8O3 |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | ethyl 1-[2-amino-6-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)anilino]pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)N1CC2CCN(c3cc(Nc4ccc(Oc5ccnc6[nH]ccc56)c(F)c4)nc(N)n3)C2C1 |
| InChI | InChI=1S/C26H27FN8O3/c1-2-37-26(36)34-13-15-7-10-35(19(15)14-34)23-12-22(32-25(28)33-23)31-16-3-4-21(18(27)11-16)38-20-6-9-30-24-17(20)5-8-29-24/h3-6,8-9,11-12,15,19H,2,7,10,13-14H2,1H3,(H,29,30)(H3,28,31,32,33) |
| InChIKey | JZQCTIMXQAMWBC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |