C24H23F4N5O5 — CID 58733519
(2S)-3-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbonyl)amino]-2-[(2,3,5,6-tetrafluorobenzoyl)amino]propanoic acid (PubChem CID 58733519) has the molecular formula C24H23F4N5O5 and a molecular weight of 537.47 g/mol. Its IUPAC name is (2S)-3-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbonyl)amino]-2-[(2,3,5,6-tetrafluorobenzoyl)amino]propanoic acid.
| Compound Name | (2S)-3-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbonyl)amino]-2-[(2,3,5,6-tetrafluorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 58733519 |
| Molecular Formula | C24H23F4N5O5 |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (2S)-3-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbonyl)amino]-2-[(2,3,5,6-tetrafluorobenzoyl)amino]propanoic acid |
| SMILES | O=C(N[C@@H](CNC(=O)N1CCC2(CC1)C(=O)NCN2c1ccccc1)C(=O)O)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C24H23F4N5O5/c25-14-10-15(26)19(28)17(18(14)27)20(34)31-16(21(35)36)11-29-23(38)32-8-6-24(7-9-32)22(37)30-12-33(24)13-4-2-1-3-5-13/h1-5,10,16H,6-9,11-12H2,(H,29,38)(H,30,37)(H,31,34)(H,35,36)/t16-/m0/s1 |
| InChIKey | FNVUDMNMPIWAPO-INIZCTEOSA-N |
| XLogP | 1.56 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|