About (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane
(2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane (PubChem CID 58733981) has the molecular formula C16H13Cl2FO3
and a molecular weight of 343.18 g/mol. Its IUPAC name is (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane.
Molecular Properties
| Compound Name | (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane |
| PubChem CID | 58733981 |
| Molecular Formula | C16H13Cl2FO3 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane |
| SMILES | COc1c(OC[C@H]2CO2)cc(F)cc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl2FO3/c1-20-16-11(15-12(17)3-2-4-13(15)18)5-9(19)6-14(16)22-8-10-7-21-10/h2-6,10H,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | AAMUOPFSGPIAKG-SNVBAGLBSA-N |
| XLogP | 4.59 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane?
The IUPAC name of (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane (CID 58733981) is (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane.
What is the SMILES notation for (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane?
The canonical SMILES for (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane is COc1c(OC[C@H]2CO2)cc(F)cc1-c1c(Cl)cccc1Cl.
What is the InChIKey of (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane?
The InChIKey is AAMUOPFSGPIAKG-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H13Cl2FO3/c1-20-16-11(15-12(17)3-2-4-13(15)18)5-9(19)6-14(16)22-8-10-7-21-10/h2-6,10H,7-8H2,1H3/t10-/m1/s1.
What are the key properties of (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane?
(2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane has a molecular weight of 343.18 g/mol, XLogP of 4.59, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[3-(2,6-dichlorophenyl)-5-fluoro-2-methoxyphenoxy]methyl]oxirane is sourced from PubChem (CID 58733981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).