C30H60Br2O3 — CID 58734101
4-(bromomethyl)-4-[2-[2-[2-(bromomethyl)-2-(2,2-dimethylpropyl)-4,4-dimethylpentoxy]ethoxy]ethoxymethyl]-2,2,6,6-tetramethylheptane (PubChem CID 58734101) has the molecular formula C30H60Br2O3 and a molecular weight of 628.62 g/mol. Its IUPAC name is 4-(bromomethyl)-4-[2-[2-[2-(bromomethyl)-2-(2,2-dimethylpropyl)-4,4-dimethylpentoxy]ethoxy]ethoxymethyl]-2,2,6,6-tetramethylheptane.
| Compound Name | 4-(bromomethyl)-4-[2-[2-[2-(bromomethyl)-2-(2,2-dimethylpropyl)-4,4-dimethylpentoxy]ethoxy]ethoxymethyl]-2,2,6,6-tetramethylheptane |
|---|---|
| PubChem CID | 58734101 |
| Molecular Formula | C30H60Br2O3 |
| Molecular Weight | 628.62 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 4-(bromomethyl)-4-[2-[2-[2-(bromomethyl)-2-(2,2-dimethylpropyl)-4,4-dimethylpentoxy]ethoxy]ethoxymethyl]-2,2,6,6-tetramethylheptane |
| SMILES | CC(C)(C)CC(CBr)(COCCOCCOCC(CBr)(CC(C)(C)C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C30H60Br2O3/c1-25(2,3)17-29(21-31,18-26(4,5)6)23-34-15-13-33-14-16-35-24-30(22-32,19-27(7,8)9)20-28(10,11)12/h13-24H2,1-12H3 |
| InChIKey | LMDFJEVAGKIPDO-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.62 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|