C29H25F6N5O2 — CID 58734209
(2S,3R)-5-[[6-[6-(trifluoromethyl)-2-[[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]-3-pyridinyl]pyrimidin-4-yl]amino]-1,2,3,4-tetrahydronaphthalene-2,3-diol (PubChem CID 58734209) has the molecular formula C29H25F6N5O2 and a molecular weight of 589.54 g/mol. Its IUPAC name is (2S,3R)-5-[[6-[6-(trifluoromethyl)-2-[[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]-3-pyridinyl]pyrimidin-4-yl]amino]-1,2,3,4-tetrahydronaphthalene-2,3-diol.
| Compound Name | (2S,3R)-5-[[6-[6-(trifluoromethyl)-2-[[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]-3-pyridinyl]pyrimidin-4-yl]amino]-1,2,3,4-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 58734209 |
| Molecular Formula | C29H25F6N5O2 |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | (2S,3R)-5-[[6-[6-(trifluoromethyl)-2-[[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]-3-pyridinyl]pyrimidin-4-yl]amino]-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| SMILES | C[C@@H](Nc1nc(C(F)(F)F)ccc1-c1cc(Nc2cccc3c2C[C@@H](O)[C@@H](O)C3)ncn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H25F6N5O2/c1-15(16-5-7-18(8-6-16)28(30,31)32)38-27-19(9-10-25(40-27)29(33,34)35)22-13-26(37-14-36-22)39-21-4-2-3-17-11-23(41)24(42)12-20(17)21/h2-10,13-15,23-24,41-42H,11-12H2,1H3,(H,38,40)(H,36,37,39)/t15-,23+,24-/m1/s1 |
| InChIKey | JLIVCYSJDOLEAQ-ZNZBMKLDSA-N |
| XLogP | 6.31 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |