C10H10BrFO — CID 58734223
8-bromo-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 58734223) has the molecular formula C10H10BrFO and a molecular weight of 245.09 g/mol. Its IUPAC name is 8-bromo-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 8-bromo-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 58734223 |
| Molecular Formula | C10H10BrFO |
| Molecular Weight | 245.09 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 8-bromo-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | OC1CCc2cc(F)cc(Br)c2C1 |
| InChI | InChI=1S/C10H10BrFO/c11-10-4-7(12)3-6-1-2-8(13)5-9(6)10/h3-4,8,13H,1-2,5H2 |
| InChIKey | UFQOXJFOVJTHPQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.09 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |