About 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid
4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid (PubChem CID 58734588) has the molecular formula C12H18O7S3
and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid.
Molecular Properties
| Compound Name | 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid |
| PubChem CID | 58734588 |
| Molecular Formula | C12H18O7S3 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid |
| SMILES | CSOOc1cc(S(=O)(=O)O)cc(OOSC)c1C(C)(C)C |
| InChI | InChI=1S/C12H18O7S3/c1-12(2,3)11-9(16-18-20-4)6-8(22(13,14)15)7-10(11)17-19-21-5/h6-7H,1-5H3,(H,13,14,15) |
| InChIKey | WVUXLCJYQQWJTA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid?
The IUPAC name of 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid (CID 58734588) is 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid.
What is the SMILES notation for 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid?
The canonical SMILES for 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid is CSOOc1cc(S(=O)(=O)O)cc(OOSC)c1C(C)(C)C.
What is the InChIKey of 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid?
The InChIKey is WVUXLCJYQQWJTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O7S3/c1-12(2,3)11-9(16-18-20-4)6-8(22(13,14)15)7-10(11)17-19-21-5/h6-7H,1-5H3,(H,13,14,15).
What are the key properties of 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid?
4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid has a molecular weight of 370.47 g/mol, XLogP of 3.41, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3,5-bis(methylsulfanylperoxy)benzenesulfonic acid is sourced from PubChem (CID 58734588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).