About (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate
(3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate (PubChem CID 58734652) has the molecular formula C9H12FO3S-
and a molecular weight of 219.26 g/mol. Its IUPAC name is (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate.
Molecular Properties
| Compound Name | (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate |
| PubChem CID | 58734652 |
| Molecular Formula | C9H12FO3S- |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate |
| SMILES | C=C(/C=C\C(=C\F)C(C)C)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H13FO3S/c1-7(2)9(6-10)5-4-8(3)14(11,12)13/h4-7H,3H2,1-2H3,(H,11,12,13)/p-1/b5-4-,9-6- |
| InChIKey | XNUNQLFGSCFGPA-WXOLFVLTSA-M |
| XLogP | 2.11 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate?
The IUPAC name of (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate (CID 58734652) is (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate.
What is the SMILES notation for (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate?
The canonical SMILES for (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate is C=C(/C=C\C(=C\F)C(C)C)S(=O)(=O)[O-].
What is the InChIKey of (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate?
The InChIKey is XNUNQLFGSCFGPA-WXOLFVLTSA-M. The full InChI is InChI=1S/C9H13FO3S/c1-7(2)9(6-10)5-4-8(3)14(11,12)13/h4-7H,3H2,1-2H3,(H,11,12,13)/p-1/b5-4-,9-6-.
What are the key properties of (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate?
(3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate has a molecular weight of 219.26 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-5-(fluoromethylidene)-6-methylhepta-1,3-diene-2-sulfonate is sourced from PubChem (CID 58734652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).