C15H25FO3S — CID 58734799
3-fluoro-2,4,6-tri(propan-2-yl)cyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 58734799) has the molecular formula C15H25FO3S and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-fluoro-2,4,6-tri(propan-2-yl)cyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 3-fluoro-2,4,6-tri(propan-2-yl)cyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 58734799 |
| Molecular Formula | C15H25FO3S |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-fluoro-2,4,6-tri(propan-2-yl)cyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | CC(C)C1=C(F)C(C(C)C)=C(S(=O)(=O)O)C(C(C)C)C1 |
| InChI | InChI=1S/C15H25FO3S/c1-8(2)11-7-12(9(3)4)15(20(17,18)19)13(10(5)6)14(11)16/h8-10,12H,7H2,1-6H3,(H,17,18,19) |
| InChIKey | QENCQQHNGOWPRI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|