About 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole
3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole (PubChem CID 58735354) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole |
| PubChem CID | 58735354 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole |
| SMILES | CC(C)C1(C(C)(C)C)CC(C(C)(C)C)=NO1 |
| InChI | InChI=1S/C14H27NO/c1-10(2)14(13(6,7)8)9-11(15-16-14)12(3,4)5/h10H,9H2,1-8H3 |
| InChIKey | JCVLYQVYTNUJIA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole?
The IUPAC name of 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole (CID 58735354) is 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole.
What is the SMILES notation for 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole?
The canonical SMILES for 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole is CC(C)C1(C(C)(C)C)CC(C(C)(C)C)=NO1.
What is the InChIKey of 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole?
The InChIKey is JCVLYQVYTNUJIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-10(2)14(13(6,7)8)9-11(15-16-14)12(3,4)5/h10H,9H2,1-8H3.
What are the key properties of 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole?
3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole has a molecular weight of 225.38 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-5-propan-2-yl-4H-1,2-oxazole is sourced from PubChem (CID 58735354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).